C21H26N4O2 — CID 94606900
(5S)-N-[(4S)-1-tert-butyl-4,5,6,7-tetrahydroindazol-4-yl]-5-phenyl-4,5-dihydro-1,2-oxazole-3-carboxamide (PubChem CID 94606900) has the molecular formula C21H26N4O2 and a molecular weight of 366.47 g/mol. Its IUPAC name is (5S)-N-[(4S)-1-tert-butyl-4,5,6,7-tetrahydroindazol-4-yl]-5-phenyl-4,5-dihydro-1,2-oxazole-3-carboxamide.
| Compound Name | (5S)-N-[(4S)-1-tert-butyl-4,5,6,7-tetrahydroindazol-4-yl]-5-phenyl-4,5-dihydro-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 94606900 |
| Molecular Formula | C21H26N4O2 |
| Molecular Weight | 366.47 g/mol |
| Exact Mass | 366.21 |
| IUPAC Name | (5S)-N-[(4S)-1-tert-butyl-4,5,6,7-tetrahydroindazol-4-yl]-5-phenyl-4,5-dihydro-1,2-oxazole-3-carboxamide |
| SMILES | CC(C)(C)n1ncc2c1CCC[C@@H]2NC(=O)C1=NO[C@H](c2ccccc2)C1 |
| InChI | InChI=1S/C21H26N4O2/c1-21(2,3)25-18-11-7-10-16(15(18)13-22-25)23-20(26)17-12-19(27-24-17)14-8-5-4-6-9-14/h4-6,8-9,13,16,19H,7,10-12H2,1-3H3,(H,23,26)/t16-,19-/m0/s1 |
| InChIKey | TWSCHMXAQAEKIC-LPHOPBHVSA-N |
| XLogP | 3.65 |
| TPSA | 68.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.47 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |