About [(2S)-1,4-dioxan-2-yl]-[(2R)-2-piperidin-4-ylpyrrolidin-1-yl]methanone
[(2S)-1,4-dioxan-2-yl]-[(2R)-2-piperidin-4-ylpyrrolidin-1-yl]methanone (PubChem CID 94607673) has the molecular formula C14H24N2O3
and a molecular weight of 268.36 g/mol. Its IUPAC name is [(2S)-1,4-dioxan-2-yl]-[(2R)-2-piperidin-4-ylpyrrolidin-1-yl]methanone.
Molecular Properties
| Compound Name | [(2S)-1,4-dioxan-2-yl]-[(2R)-2-piperidin-4-ylpyrrolidin-1-yl]methanone |
| PubChem CID | 94607673 |
| Molecular Formula | C14H24N2O3 |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.18 |
| IUPAC Name | [(2S)-1,4-dioxan-2-yl]-[(2R)-2-piperidin-4-ylpyrrolidin-1-yl]methanone |
| SMILES | O=C([C@@H]1COCCO1)N1CCC[C@@H]1C1CCNCC1 |
| InChI | InChI=1S/C14H24N2O3/c17-14(13-10-18-8-9-19-13)16-7-1-2-12(16)11-3-5-15-6-4-11/h11-13,15H,1-10H2/t12-,13+/m1/s1 |
| InChIKey | YCOIFKMRQVEGBO-OLZOCXBDSA-N |
| XLogP | 0.39 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [(2S)-1,4-dioxan-2-yl]-[(2R)-2-piperidin-4-ylpyrrolidin-1-yl]methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2S)-1,4-dioxan-2-yl]-[(2R)-2-piperidin-4-ylpyrrolidin-1-yl]methanone?
The IUPAC name of [(2S)-1,4-dioxan-2-yl]-[(2R)-2-piperidin-4-ylpyrrolidin-1-yl]methanone (CID 94607673) is [(2S)-1,4-dioxan-2-yl]-[(2R)-2-piperidin-4-ylpyrrolidin-1-yl]methanone.
What is the SMILES notation for [(2S)-1,4-dioxan-2-yl]-[(2R)-2-piperidin-4-ylpyrrolidin-1-yl]methanone?
The canonical SMILES for [(2S)-1,4-dioxan-2-yl]-[(2R)-2-piperidin-4-ylpyrrolidin-1-yl]methanone is O=C([C@@H]1COCCO1)N1CCC[C@@H]1C1CCNCC1.
What is the InChIKey of [(2S)-1,4-dioxan-2-yl]-[(2R)-2-piperidin-4-ylpyrrolidin-1-yl]methanone?
The InChIKey is YCOIFKMRQVEGBO-OLZOCXBDSA-N. The full InChI is InChI=1S/C14H24N2O3/c17-14(13-10-18-8-9-19-13)16-7-1-2-12(16)11-3-5-15-6-4-11/h11-13,15H,1-10H2/t12-,13+/m1/s1.
What are the key properties of [(2S)-1,4-dioxan-2-yl]-[(2R)-2-piperidin-4-ylpyrrolidin-1-yl]methanone?
[(2S)-1,4-dioxan-2-yl]-[(2R)-2-piperidin-4-ylpyrrolidin-1-yl]methanone has a molecular weight of 268.36 g/mol, XLogP of 0.39, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(2S)-1,4-dioxan-2-yl]-[(2R)-2-piperidin-4-ylpyrrolidin-1-yl]methanone is sourced from PubChem (CID 94607673), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).