C18H19FN2O4 — CID 94612751
methyl N-[2-[[(1S)-2-(2-fluorophenoxy)-1-phenylethyl]amino]-2-oxoethyl]carbamate (PubChem CID 94612751) has the molecular formula C18H19FN2O4 and a molecular weight of 346.36 g/mol. Its IUPAC name is methyl N-[2-[[(1S)-2-(2-fluorophenoxy)-1-phenylethyl]amino]-2-oxoethyl]carbamate.
| Compound Name | methyl N-[2-[[(1S)-2-(2-fluorophenoxy)-1-phenylethyl]amino]-2-oxoethyl]carbamate |
|---|---|
| PubChem CID | 94612751 |
| Molecular Formula | C18H19FN2O4 |
| Molecular Weight | 346.36 g/mol |
| Exact Mass | 346.13 |
| IUPAC Name | methyl N-[2-[[(1S)-2-(2-fluorophenoxy)-1-phenylethyl]amino]-2-oxoethyl]carbamate |
| SMILES | COC(=O)NCC(=O)N[C@H](COc1ccccc1F)c1ccccc1 |
| InChI | InChI=1S/C18H19FN2O4/c1-24-18(23)20-11-17(22)21-15(13-7-3-2-4-8-13)12-25-16-10-6-5-9-14(16)19/h2-10,15H,11-12H2,1H3,(H,20,23)(H,21,22)/t15-/m1/s1 |
| InChIKey | VGEZPNAZSQFTEW-OAHLLOKOSA-N |
| XLogP | 2.42 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.36 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |