C14H9BrN4O3S — CID 9461528
4-[(Z)-(6-bromo-1,3-benzodioxol-5-yl)methylideneamino]-3-(furan-2-yl)-1H-1,2,4-triazole-5-thione (PubChem CID 9461528) has the molecular formula C14H9BrN4O3S and a molecular weight of 393.22 g/mol. Its IUPAC name is 4-[(Z)-(6-bromo-1,3-benzodioxol-5-yl)methylideneamino]-3-(furan-2-yl)-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-[(Z)-(6-bromo-1,3-benzodioxol-5-yl)methylideneamino]-3-(furan-2-yl)-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 9461528 |
| Molecular Formula | C14H9BrN4O3S |
| Molecular Weight | 393.22 g/mol |
| Exact Mass | 391.96 |
| IUPAC Name | 4-[(Z)-(6-bromo-1,3-benzodioxol-5-yl)methylideneamino]-3-(furan-2-yl)-1H-1,2,4-triazole-5-thione |
| SMILES | S=c1[nH]nc(-c2ccco2)n1/N=C\c1cc2c(cc1Br)OCO2 |
| InChI | InChI=1S/C14H9BrN4O3S/c15-9-5-12-11(21-7-22-12)4-8(9)6-16-19-13(17-18-14(19)23)10-2-1-3-20-10/h1-6H,7H2,(H,18,23)/b16-6- |
| InChIKey | CCWLKPABBHHIEN-SOFYXZRVSA-N |
| XLogP | 3.57 |
| TPSA | 77.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.22 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|