About 1-methyl-N'-[(Z)-2-(4-methylphenyl)ethenyl]sulfonylpyrrole-2-carbohydrazide
1-methyl-N'-[(Z)-2-(4-methylphenyl)ethenyl]sulfonylpyrrole-2-carbohydrazide (PubChem CID 94619291) has the molecular formula C15H17N3O3S
and a molecular weight of 319.39 g/mol. Its IUPAC name is 1-methyl-N'-[(Z)-2-(4-methylphenyl)ethenyl]sulfonylpyrrole-2-carbohydrazide.
Molecular Properties
| Compound Name | 1-methyl-N'-[(Z)-2-(4-methylphenyl)ethenyl]sulfonylpyrrole-2-carbohydrazide |
| PubChem CID | 94619291 |
| Molecular Formula | C15H17N3O3S |
| Molecular Weight | 319.39 g/mol |
| Exact Mass | 319.10 |
| IUPAC Name | 1-methyl-N'-[(Z)-2-(4-methylphenyl)ethenyl]sulfonylpyrrole-2-carbohydrazide |
| SMILES | Cc1ccc(/C=C\S(=O)(=O)NNC(=O)c2cccn2C)cc1 |
| InChI | InChI=1S/C15H17N3O3S/c1-12-5-7-13(8-6-12)9-11-22(20,21)17-16-15(19)14-4-3-10-18(14)2/h3-11,17H,1-2H3,(H,16,19)/b11-9- |
| InChIKey | KPDZGIWIKGYQGE-LUAWRHEFSA-N |
| XLogP | 1.57 |
| TPSA | 80.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.39 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-methyl-N'-[(Z)-2-(4-methylphenyl)ethenyl]sulfonylpyrrole-2-carbohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-N'-[(Z)-2-(4-methylphenyl)ethenyl]sulfonylpyrrole-2-carbohydrazide?
The IUPAC name of 1-methyl-N'-[(Z)-2-(4-methylphenyl)ethenyl]sulfonylpyrrole-2-carbohydrazide (CID 94619291) is 1-methyl-N'-[(Z)-2-(4-methylphenyl)ethenyl]sulfonylpyrrole-2-carbohydrazide.
What is the SMILES notation for 1-methyl-N'-[(Z)-2-(4-methylphenyl)ethenyl]sulfonylpyrrole-2-carbohydrazide?
The canonical SMILES for 1-methyl-N'-[(Z)-2-(4-methylphenyl)ethenyl]sulfonylpyrrole-2-carbohydrazide is Cc1ccc(/C=C\S(=O)(=O)NNC(=O)c2cccn2C)cc1.
What is the InChIKey of 1-methyl-N'-[(Z)-2-(4-methylphenyl)ethenyl]sulfonylpyrrole-2-carbohydrazide?
The InChIKey is KPDZGIWIKGYQGE-LUAWRHEFSA-N. The full InChI is InChI=1S/C15H17N3O3S/c1-12-5-7-13(8-6-12)9-11-22(20,21)17-16-15(19)14-4-3-10-18(14)2/h3-11,17H,1-2H3,(H,16,19)/b11-9-.
What are the key properties of 1-methyl-N'-[(Z)-2-(4-methylphenyl)ethenyl]sulfonylpyrrole-2-carbohydrazide?
1-methyl-N'-[(Z)-2-(4-methylphenyl)ethenyl]sulfonylpyrrole-2-carbohydrazide has a molecular weight of 319.39 g/mol, XLogP of 1.57, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-N'-[(Z)-2-(4-methylphenyl)ethenyl]sulfonylpyrrole-2-carbohydrazide is sourced from PubChem (CID 94619291), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).