C18H12N4O2 — CID 946197
(9R)-3-phenyl-1,3,4,8-tetrazatetracyclo[7.7.0.02,6.010,15]hexadeca-2(6),4,10,12,14-pentaene-7,16-dione (PubChem CID 946197) has the molecular formula C18H12N4O2 and a molecular weight of 316.32 g/mol. Its IUPAC name is (9R)-3-phenyl-1,3,4,8-tetrazatetracyclo[7.7.0.02,6.010,15]hexadeca-2(6),4,10,12,14-pentaene-7,16-dione.
| Compound Name | (9R)-3-phenyl-1,3,4,8-tetrazatetracyclo[7.7.0.02,6.010,15]hexadeca-2(6),4,10,12,14-pentaene-7,16-dione |
|---|---|
| PubChem CID | 946197 |
| Molecular Formula | C18H12N4O2 |
| Molecular Weight | 316.32 g/mol |
| Exact Mass | 316.10 |
| IUPAC Name | (9R)-3-phenyl-1,3,4,8-tetrazatetracyclo[7.7.0.02,6.010,15]hexadeca-2(6),4,10,12,14-pentaene-7,16-dione |
| SMILES | O=C1N[C@H]2c3ccccc3C(=O)N2c2c1cnn2-c1ccccc1 |
| InChI | InChI=1S/C18H12N4O2/c23-16-14-10-19-22(11-6-2-1-3-7-11)17(14)21-15(20-16)12-8-4-5-9-13(12)18(21)24/h1-10,15H,(H,20,23)/t15-/m1/s1 |
| InChIKey | FGYIGBHAOHHCHP-OAHLLOKOSA-N |
| XLogP | 2.27 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.32 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |