C19H22N4O2S — CID 9462050
(2R)-N-(3-cyanothiophen-2-yl)-2-[4-(4-methoxyphenyl)piperazin-1-yl]propanamide (PubChem CID 9462050) has the molecular formula C19H22N4O2S and a molecular weight of 370.48 g/mol. Its IUPAC name is (2R)-N-(3-cyanothiophen-2-yl)-2-[4-(4-methoxyphenyl)piperazin-1-yl]propanamide.
| Compound Name | (2R)-N-(3-cyanothiophen-2-yl)-2-[4-(4-methoxyphenyl)piperazin-1-yl]propanamide |
|---|---|
| PubChem CID | 9462050 |
| Molecular Formula | C19H22N4O2S |
| Molecular Weight | 370.48 g/mol |
| Exact Mass | 370.15 |
| IUPAC Name | (2R)-N-(3-cyanothiophen-2-yl)-2-[4-(4-methoxyphenyl)piperazin-1-yl]propanamide |
| SMILES | COc1ccc(N2CCN([C@H](C)C(=O)Nc3sccc3C#N)CC2)cc1 |
| InChI | InChI=1S/C19H22N4O2S/c1-14(18(24)21-19-15(13-20)7-12-26-19)22-8-10-23(11-9-22)16-3-5-17(25-2)6-4-16/h3-7,12,14H,8-11H2,1-2H3,(H,21,24)/t14-/m1/s1 |
| InChIKey | PAHKBTHQJHDCEA-CQSZACIVSA-N |
| XLogP | 2.78 |
| TPSA | 68.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.48 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|