C22H21N5O2 — CID 9462061
5-[(Z)-(4-butoxyphenyl)methylideneamino]-1-phenylpyrazolo[5,4-d]pyrimidin-4-one (PubChem CID 9462061) has the molecular formula C22H21N5O2 and a molecular weight of 387.44 g/mol. Its IUPAC name is 5-[(Z)-(4-butoxyphenyl)methylideneamino]-1-phenylpyrazolo[5,4-d]pyrimidin-4-one.
| Compound Name | 5-[(Z)-(4-butoxyphenyl)methylideneamino]-1-phenylpyrazolo[5,4-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 9462061 |
| Molecular Formula | C22H21N5O2 |
| Molecular Weight | 387.44 g/mol |
| Exact Mass | 387.17 |
| IUPAC Name | 5-[(Z)-(4-butoxyphenyl)methylideneamino]-1-phenylpyrazolo[5,4-d]pyrimidin-4-one |
| SMILES | CCCCOc1ccc(/C=N\n2cnc3c(cnn3-c3ccccc3)c2=O)cc1 |
| InChI | InChI=1S/C22H21N5O2/c1-2-3-13-29-19-11-9-17(10-12-19)14-24-26-16-23-21-20(22(26)28)15-25-27(21)18-7-5-4-6-8-18/h4-12,14-16H,2-3,13H2,1H3/b24-14- |
| InChIKey | BWTIQRNLUXFSBK-OYKKKHCWSA-N |
| XLogP | 3.64 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.44 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|