C19H19N3 — CID 946227
3,4,5,7-tetramethyl-11-phenyl-4,8,9-triazatricyclo[7.3.0.02,6]dodeca-1(12),2,5,7,10-pentaene (PubChem CID 946227) has the molecular formula C19H19N3 and a molecular weight of 289.38 g/mol. Its IUPAC name is 3,4,5,7-tetramethyl-11-phenyl-4,8,9-triazatricyclo[7.3.0.02,6]dodeca-1(12),2,5,7,10-pentaene.
| Compound Name | 3,4,5,7-tetramethyl-11-phenyl-4,8,9-triazatricyclo[7.3.0.02,6]dodeca-1(12),2,5,7,10-pentaene |
|---|---|
| PubChem CID | 946227 |
| Molecular Formula | C19H19N3 |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.16 |
| IUPAC Name | 3,4,5,7-tetramethyl-11-phenyl-4,8,9-triazatricyclo[7.3.0.02,6]dodeca-1(12),2,5,7,10-pentaene |
| SMILES | Cc1nn2cc(-c3ccccc3)cc2c2c(C)n(C)c(C)c12 |
| InChI | InChI=1S/C19H19N3/c1-12-18-13(2)21(4)14(3)19(18)17-10-16(11-22(17)20-12)15-8-6-5-7-9-15/h5-11H,1-4H3 |
| InChIKey | LXOMXYPTONAMJH-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 22.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |