C19H24N2O4S — CID 94623465
3-(dimethylsulfamoyl)-N-[(2S)-1-(2-methylphenoxy)propan-2-yl]benzamide (PubChem CID 94623465) has the molecular formula C19H24N2O4S and a molecular weight of 376.48 g/mol. Its IUPAC name is 3-(dimethylsulfamoyl)-N-[(2S)-1-(2-methylphenoxy)propan-2-yl]benzamide.
| Compound Name | 3-(dimethylsulfamoyl)-N-[(2S)-1-(2-methylphenoxy)propan-2-yl]benzamide |
|---|---|
| PubChem CID | 94623465 |
| Molecular Formula | C19H24N2O4S |
| Molecular Weight | 376.48 g/mol |
| Exact Mass | 376.15 |
| IUPAC Name | 3-(dimethylsulfamoyl)-N-[(2S)-1-(2-methylphenoxy)propan-2-yl]benzamide |
| SMILES | Cc1ccccc1OC[C@H](C)NC(=O)c1cccc(S(=O)(=O)N(C)C)c1 |
| InChI | InChI=1S/C19H24N2O4S/c1-14-8-5-6-11-18(14)25-13-15(2)20-19(22)16-9-7-10-17(12-16)26(23,24)21(3)4/h5-12,15H,13H2,1-4H3,(H,20,22)/t15-/m0/s1 |
| InChIKey | FQCAPGMAMFBMRE-HNNXBMFYSA-N |
| XLogP | 2.44 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.48 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |