About [4-[2-(2,5-dimethylpyrrol-1-yl)thiophene-3-carbonyl]piperazin-1-yl]-phenylmethanone
[4-[2-(2,5-dimethylpyrrol-1-yl)thiophene-3-carbonyl]piperazin-1-yl]-phenylmethanone (PubChem CID 9462360) has the molecular formula C22H23N3O2S
and a molecular weight of 393.51 g/mol. Its IUPAC name is [4-[2-(2,5-dimethylpyrrol-1-yl)thiophene-3-carbonyl]piperazin-1-yl]-phenylmethanone.
Molecular Properties
| Compound Name | [4-[2-(2,5-dimethylpyrrol-1-yl)thiophene-3-carbonyl]piperazin-1-yl]-phenylmethanone |
| PubChem CID | 9462360 |
| Molecular Formula | C22H23N3O2S |
| Molecular Weight | 393.51 g/mol |
| Exact Mass | 393.15 |
| IUPAC Name | [4-[2-(2,5-dimethylpyrrol-1-yl)thiophene-3-carbonyl]piperazin-1-yl]-phenylmethanone |
| SMILES | Cc1ccc(C)n1-c1sccc1C(=O)N1CCN(C(=O)c2ccccc2)CC1 |
| InChI | InChI=1S/C22H23N3O2S/c1-16-8-9-17(2)25(16)22-19(10-15-28-22)21(27)24-13-11-23(12-14-24)20(26)18-6-4-3-5-7-18/h3-10,15H,11-14H2,1-2H3 |
| InChIKey | FDMDBDRGRNHLHK-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 45.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 393.51 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [4-[2-(2,5-dimethylpyrrol-1-yl)thiophene-3-carbonyl]piperazin-1-yl]-phenylmethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[2-(2,5-dimethylpyrrol-1-yl)thiophene-3-carbonyl]piperazin-1-yl]-phenylmethanone?
The IUPAC name of [4-[2-(2,5-dimethylpyrrol-1-yl)thiophene-3-carbonyl]piperazin-1-yl]-phenylmethanone (CID 9462360) is [4-[2-(2,5-dimethylpyrrol-1-yl)thiophene-3-carbonyl]piperazin-1-yl]-phenylmethanone.
What is the SMILES notation for [4-[2-(2,5-dimethylpyrrol-1-yl)thiophene-3-carbonyl]piperazin-1-yl]-phenylmethanone?
The canonical SMILES for [4-[2-(2,5-dimethylpyrrol-1-yl)thiophene-3-carbonyl]piperazin-1-yl]-phenylmethanone is Cc1ccc(C)n1-c1sccc1C(=O)N1CCN(C(=O)c2ccccc2)CC1.
What is the InChIKey of [4-[2-(2,5-dimethylpyrrol-1-yl)thiophene-3-carbonyl]piperazin-1-yl]-phenylmethanone?
The InChIKey is FDMDBDRGRNHLHK-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H23N3O2S/c1-16-8-9-17(2)25(16)22-19(10-15-28-22)21(27)24-13-11-23(12-14-24)20(26)18-6-4-3-5-7-18/h3-10,15H,11-14H2,1-2H3.
What are the key properties of [4-[2-(2,5-dimethylpyrrol-1-yl)thiophene-3-carbonyl]piperazin-1-yl]-phenylmethanone?
[4-[2-(2,5-dimethylpyrrol-1-yl)thiophene-3-carbonyl]piperazin-1-yl]-phenylmethanone has a molecular weight of 393.51 g/mol, XLogP of 3.75, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[2-(2,5-dimethylpyrrol-1-yl)thiophene-3-carbonyl]piperazin-1-yl]-phenylmethanone is sourced from PubChem (CID 9462360), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).