C18H21NO2 — CID 94625096
2,4-dimethyl-N-[(2S)-1-phenoxypropan-2-yl]benzamide (PubChem CID 94625096) has the molecular formula C18H21NO2 and a molecular weight of 283.37 g/mol. Its IUPAC name is 2,4-dimethyl-N-[(2S)-1-phenoxypropan-2-yl]benzamide.
| Compound Name | 2,4-dimethyl-N-[(2S)-1-phenoxypropan-2-yl]benzamide |
|---|---|
| PubChem CID | 94625096 |
| Molecular Formula | C18H21NO2 |
| Molecular Weight | 283.37 g/mol |
| Exact Mass | 283.16 |
| IUPAC Name | 2,4-dimethyl-N-[(2S)-1-phenoxypropan-2-yl]benzamide |
| SMILES | Cc1ccc(C(=O)N[C@@H](C)COc2ccccc2)c(C)c1 |
| InChI | InChI=1S/C18H21NO2/c1-13-9-10-17(14(2)11-13)18(20)19-15(3)12-21-16-7-5-4-6-8-16/h4-11,15H,12H2,1-3H3,(H,19,20)/t15-/m0/s1 |
| InChIKey | ZHXFCADOXOPJNQ-HNNXBMFYSA-N |
| XLogP | 3.50 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.37 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |