C21H22N4O3S — CID 9463227
2-[(5-methyl-1,2-oxazol-3-yl)methylsulfanyl]-N-(4-morpholin-4-ylphenyl)pyridine-3-carboxamide (PubChem CID 9463227) has the molecular formula C21H22N4O3S and a molecular weight of 410.50 g/mol. Its IUPAC name is 2-[(5-methyl-1,2-oxazol-3-yl)methylsulfanyl]-N-(4-morpholin-4-ylphenyl)pyridine-3-carboxamide.
| Compound Name | 2-[(5-methyl-1,2-oxazol-3-yl)methylsulfanyl]-N-(4-morpholin-4-ylphenyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 9463227 |
| Molecular Formula | C21H22N4O3S |
| Molecular Weight | 410.50 g/mol |
| Exact Mass | 410.14 |
| IUPAC Name | 2-[(5-methyl-1,2-oxazol-3-yl)methylsulfanyl]-N-(4-morpholin-4-ylphenyl)pyridine-3-carboxamide |
| SMILES | Cc1cc(CSc2ncccc2C(=O)Nc2ccc(N3CCOCC3)cc2)no1 |
| InChI | InChI=1S/C21H22N4O3S/c1-15-13-17(24-28-15)14-29-21-19(3-2-8-22-21)20(26)23-16-4-6-18(7-5-16)25-9-11-27-12-10-25/h2-8,13H,9-12,14H2,1H3,(H,23,26) |
| InChIKey | VFJSKCJMPXYLQD-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 80.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.50 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|