C12H11Cl2N3 — CID 9463576
N-[(Z)-[(1R,5S)-6-bicyclo[3.2.0]hept-2-enylidene]amino]-3,5-dichloropyridin-2-amine (PubChem CID 9463576) has the molecular formula C12H11Cl2N3 and a molecular weight of 268.15 g/mol. Its IUPAC name is N-[(Z)-[(1R,5S)-6-bicyclo[3.2.0]hept-2-enylidene]amino]-3,5-dichloropyridin-2-amine.
| Compound Name | N-[(Z)-[(1R,5S)-6-bicyclo[3.2.0]hept-2-enylidene]amino]-3,5-dichloropyridin-2-amine |
|---|---|
| PubChem CID | 9463576 |
| Molecular Formula | C12H11Cl2N3 |
| Molecular Weight | 268.15 g/mol |
| Exact Mass | 267.03 |
| IUPAC Name | N-[(Z)-[(1R,5S)-6-bicyclo[3.2.0]hept-2-enylidene]amino]-3,5-dichloropyridin-2-amine |
| SMILES | Clc1cnc(N/N=C2/C[C@@H]3C=CC[C@H]23)c(Cl)c1 |
| InChI | InChI=1S/C12H11Cl2N3/c13-8-5-10(14)12(15-6-8)17-16-11-4-7-2-1-3-9(7)11/h1-2,5-7,9H,3-4H2,(H,15,17)/b16-11-/t7-,9-/m0/s1 |
| InChIKey | ZYNNSTGMKIWTGB-QNOFAVNISA-N |
| XLogP | 3.75 |
| TPSA | 37.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.15 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|