C21H24N2O4S — CID 94636278
(3R,6S)-1-[4-(benzenesulfonylmethyl)benzoyl]-6-methylpiperidine-3-carboxamide (PubChem CID 94636278) has the molecular formula C21H24N2O4S and a molecular weight of 400.50 g/mol. Its IUPAC name is (3R,6S)-1-[4-(benzenesulfonylmethyl)benzoyl]-6-methylpiperidine-3-carboxamide.
| Compound Name | (3R,6S)-1-[4-(benzenesulfonylmethyl)benzoyl]-6-methylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 94636278 |
| Molecular Formula | C21H24N2O4S |
| Molecular Weight | 400.50 g/mol |
| Exact Mass | 400.15 |
| IUPAC Name | (3R,6S)-1-[4-(benzenesulfonylmethyl)benzoyl]-6-methylpiperidine-3-carboxamide |
| SMILES | C[C@H]1CC[C@@H](C(N)=O)CN1C(=O)c1ccc(CS(=O)(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C21H24N2O4S/c1-15-7-10-18(20(22)24)13-23(15)21(25)17-11-8-16(9-12-17)14-28(26,27)19-5-3-2-4-6-19/h2-6,8-9,11-12,15,18H,7,10,13-14H2,1H3,(H2,22,24)/t15-,18+/m0/s1 |
| InChIKey | YWHKJKJSKUDYBV-MAUKXSAKSA-N |
| XLogP | 2.39 |
| TPSA | 97.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.50 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |