C18H26N2O4 — CID 94636730
(2S)-1-[4-(2,4-dimethoxybenzoyl)piperazin-1-yl]-2-methylbutan-1-one (PubChem CID 94636730) has the molecular formula C18H26N2O4 and a molecular weight of 334.42 g/mol. Its IUPAC name is (2S)-1-[4-(2,4-dimethoxybenzoyl)piperazin-1-yl]-2-methylbutan-1-one.
| Compound Name | (2S)-1-[4-(2,4-dimethoxybenzoyl)piperazin-1-yl]-2-methylbutan-1-one |
|---|---|
| PubChem CID | 94636730 |
| Molecular Formula | C18H26N2O4 |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.19 |
| IUPAC Name | (2S)-1-[4-(2,4-dimethoxybenzoyl)piperazin-1-yl]-2-methylbutan-1-one |
| SMILES | CC[C@H](C)C(=O)N1CCN(C(=O)c2ccc(OC)cc2OC)CC1 |
| InChI | InChI=1S/C18H26N2O4/c1-5-13(2)17(21)19-8-10-20(11-9-19)18(22)15-7-6-14(23-3)12-16(15)24-4/h6-7,12-13H,5,8-11H2,1-4H3/t13-/m0/s1 |
| InChIKey | DYFOMMOFZRVZNE-ZDUSSCGKSA-N |
| XLogP | 2.03 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |