C20H25N3O2 — CID 94637107
4-[(2R)-2-cyclopentylpyrrolidine-1-carbonyl]-2-ethylphthalazin-1-one (PubChem CID 94637107) has the molecular formula C20H25N3O2 and a molecular weight of 339.44 g/mol. Its IUPAC name is 4-[(2R)-2-cyclopentylpyrrolidine-1-carbonyl]-2-ethylphthalazin-1-one.
| Compound Name | 4-[(2R)-2-cyclopentylpyrrolidine-1-carbonyl]-2-ethylphthalazin-1-one |
|---|---|
| PubChem CID | 94637107 |
| Molecular Formula | C20H25N3O2 |
| Molecular Weight | 339.44 g/mol |
| Exact Mass | 339.19 |
| IUPAC Name | 4-[(2R)-2-cyclopentylpyrrolidine-1-carbonyl]-2-ethylphthalazin-1-one |
| SMILES | CCn1nc(C(=O)N2CCC[C@@H]2C2CCCC2)c2ccccc2c1=O |
| InChI | InChI=1S/C20H25N3O2/c1-2-23-19(24)16-11-6-5-10-15(16)18(21-23)20(25)22-13-7-12-17(22)14-8-3-4-9-14/h5-6,10-11,14,17H,2-4,7-9,12-13H2,1H3/t17-/m1/s1 |
| InChIKey | XUQYPUFPKBEVKQ-QGZVFWFLSA-N |
| XLogP | 3.21 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.44 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |