C21H20Cl2N2O3 — CID 94642545
(E)-3-(2,6-dichlorophenyl)-N-[2-methyl-3-(morpholine-4-carbonyl)phenyl]prop-2-enamide (PubChem CID 94642545) has the molecular formula C21H20Cl2N2O3 and a molecular weight of 419.31 g/mol. Its IUPAC name is (E)-3-(2,6-dichlorophenyl)-N-[2-methyl-3-(morpholine-4-carbonyl)phenyl]prop-2-enamide.
| Compound Name | (E)-3-(2,6-dichlorophenyl)-N-[2-methyl-3-(morpholine-4-carbonyl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 94642545 |
| Molecular Formula | C21H20Cl2N2O3 |
| Molecular Weight | 419.31 g/mol |
| Exact Mass | 418.09 |
| IUPAC Name | (E)-3-(2,6-dichlorophenyl)-N-[2-methyl-3-(morpholine-4-carbonyl)phenyl]prop-2-enamide |
| SMILES | Cc1c(NC(=O)/C=C/c2c(Cl)cccc2Cl)cccc1C(=O)N1CCOCC1 |
| InChI | InChI=1S/C21H20Cl2N2O3/c1-14-15(21(27)25-10-12-28-13-11-25)4-2-7-19(14)24-20(26)9-8-16-17(22)5-3-6-18(16)23/h2-9H,10-13H2,1H3,(H,24,26)/b9-8+ |
| InChIKey | FJUABICXWQYSFU-CMDGGOBGSA-N |
| XLogP | 4.43 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.31 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|