C17H17N5O4S — CID 9464584
3,4-dimethoxy-N'-[2-([1,2,4]triazolo[4,3-a]pyridin-3-ylsulfanyl)acetyl]benzohydrazide (PubChem CID 9464584) has the molecular formula C17H17N5O4S and a molecular weight of 387.42 g/mol. Its IUPAC name is 3,4-dimethoxy-N'-[2-([1,2,4]triazolo[4,3-a]pyridin-3-ylsulfanyl)acetyl]benzohydrazide.
| Compound Name | 3,4-dimethoxy-N'-[2-([1,2,4]triazolo[4,3-a]pyridin-3-ylsulfanyl)acetyl]benzohydrazide |
|---|---|
| PubChem CID | 9464584 |
| Molecular Formula | C17H17N5O4S |
| Molecular Weight | 387.42 g/mol |
| Exact Mass | 387.10 |
| IUPAC Name | 3,4-dimethoxy-N'-[2-([1,2,4]triazolo[4,3-a]pyridin-3-ylsulfanyl)acetyl]benzohydrazide |
| SMILES | COc1ccc(C(=O)NNC(=O)CSc2nnc3ccccn23)cc1OC |
| InChI | InChI=1S/C17H17N5O4S/c1-25-12-7-6-11(9-13(12)26-2)16(24)20-19-15(23)10-27-17-21-18-14-5-3-4-8-22(14)17/h3-9H,10H2,1-2H3,(H,19,23)(H,20,24) |
| InChIKey | BEQNYMMZAPJHCM-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 106.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.42 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|