About N-[(1R)-1-(2,5-dimethylthiophen-3-yl)ethyl]-2-[methyl(7H-purin-6-yl)amino]acetamide
N-[(1R)-1-(2,5-dimethylthiophen-3-yl)ethyl]-2-[methyl(7H-purin-6-yl)amino]acetamide (PubChem CID 94658120) has the molecular formula C16H20N6OS
and a molecular weight of 344.44 g/mol. Its IUPAC name is N-[(1R)-1-(2,5-dimethylthiophen-3-yl)ethyl]-2-[methyl(7H-purin-6-yl)amino]acetamide.
Molecular Properties
| Compound Name | N-[(1R)-1-(2,5-dimethylthiophen-3-yl)ethyl]-2-[methyl(7H-purin-6-yl)amino]acetamide |
| PubChem CID | 94658120 |
| Molecular Formula | C16H20N6OS |
| Molecular Weight | 344.44 g/mol |
| Exact Mass | 344.14 |
| IUPAC Name | N-[(1R)-1-(2,5-dimethylthiophen-3-yl)ethyl]-2-[methyl(7H-purin-6-yl)amino]acetamide |
| SMILES | Cc1cc([C@@H](C)NC(=O)CN(C)c2ncnc3nc[nH]c23)c(C)s1 |
| InChI | InChI=1S/C16H20N6OS/c1-9-5-12(11(3)24-9)10(2)21-13(23)6-22(4)16-14-15(18-7-17-14)19-8-20-16/h5,7-8,10H,6H2,1-4H3,(H,21,23)(H,17,18,19,20)/t10-/m1/s1 |
| InChIKey | MWTBKBPPIYRALT-SNVBAGLBSA-N |
| XLogP | 2.34 |
| TPSA | 86.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.44 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-[(1R)-1-(2,5-dimethylthiophen-3-yl)ethyl]-2-[methyl(7H-purin-6-yl)amino]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(1R)-1-(2,5-dimethylthiophen-3-yl)ethyl]-2-[methyl(7H-purin-6-yl)amino]acetamide?
The IUPAC name of N-[(1R)-1-(2,5-dimethylthiophen-3-yl)ethyl]-2-[methyl(7H-purin-6-yl)amino]acetamide (CID 94658120) is N-[(1R)-1-(2,5-dimethylthiophen-3-yl)ethyl]-2-[methyl(7H-purin-6-yl)amino]acetamide.
What is the SMILES notation for N-[(1R)-1-(2,5-dimethylthiophen-3-yl)ethyl]-2-[methyl(7H-purin-6-yl)amino]acetamide?
The canonical SMILES for N-[(1R)-1-(2,5-dimethylthiophen-3-yl)ethyl]-2-[methyl(7H-purin-6-yl)amino]acetamide is Cc1cc([C@@H](C)NC(=O)CN(C)c2ncnc3nc[nH]c23)c(C)s1.
What is the InChIKey of N-[(1R)-1-(2,5-dimethylthiophen-3-yl)ethyl]-2-[methyl(7H-purin-6-yl)amino]acetamide?
The InChIKey is MWTBKBPPIYRALT-SNVBAGLBSA-N. The full InChI is InChI=1S/C16H20N6OS/c1-9-5-12(11(3)24-9)10(2)21-13(23)6-22(4)16-14-15(18-7-17-14)19-8-20-16/h5,7-8,10H,6H2,1-4H3,(H,21,23)(H,17,18,19,20)/t10-/m1/s1.
What are the key properties of N-[(1R)-1-(2,5-dimethylthiophen-3-yl)ethyl]-2-[methyl(7H-purin-6-yl)amino]acetamide?
N-[(1R)-1-(2,5-dimethylthiophen-3-yl)ethyl]-2-[methyl(7H-purin-6-yl)amino]acetamide has a molecular weight of 344.44 g/mol, XLogP of 2.34, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(1R)-1-(2,5-dimethylthiophen-3-yl)ethyl]-2-[methyl(7H-purin-6-yl)amino]acetamide is sourced from PubChem (CID 94658120), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).