C20H25N3O2S — CID 94666381
(4S)-N-cycloheptyl-3-(1H-indole-3-carbonyl)-1,3-thiazolidine-4-carboxamide (PubChem CID 94666381) has the molecular formula C20H25N3O2S and a molecular weight of 371.51 g/mol. Its IUPAC name is (4S)-N-cycloheptyl-3-(1H-indole-3-carbonyl)-1,3-thiazolidine-4-carboxamide.
| Compound Name | (4S)-N-cycloheptyl-3-(1H-indole-3-carbonyl)-1,3-thiazolidine-4-carboxamide |
|---|---|
| PubChem CID | 94666381 |
| Molecular Formula | C20H25N3O2S |
| Molecular Weight | 371.51 g/mol |
| Exact Mass | 371.17 |
| IUPAC Name | (4S)-N-cycloheptyl-3-(1H-indole-3-carbonyl)-1,3-thiazolidine-4-carboxamide |
| SMILES | O=C(NC1CCCCCC1)[C@H]1CSCN1C(=O)c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C20H25N3O2S/c24-19(22-14-7-3-1-2-4-8-14)18-12-26-13-23(18)20(25)16-11-21-17-10-6-5-9-15(16)17/h5-6,9-11,14,18,21H,1-4,7-8,12-13H2,(H,22,24)/t18-/m1/s1 |
| InChIKey | ZYOKZPKQNVDBGI-GOSISDBHSA-N |
| XLogP | 3.52 |
| TPSA | 65.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.51 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |