C16H21ClN2O2 — CID 94667978
2-(4-chlorophenyl)-N-[(2R)-1-oxo-1-piperidin-1-ylpropan-2-yl]acetamide (PubChem CID 94667978) has the molecular formula C16H21ClN2O2 and a molecular weight of 308.81 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-N-[(2R)-1-oxo-1-piperidin-1-ylpropan-2-yl]acetamide.
| Compound Name | 2-(4-chlorophenyl)-N-[(2R)-1-oxo-1-piperidin-1-ylpropan-2-yl]acetamide |
|---|---|
| PubChem CID | 94667978 |
| Molecular Formula | C16H21ClN2O2 |
| Molecular Weight | 308.81 g/mol |
| Exact Mass | 308.13 |
| IUPAC Name | 2-(4-chlorophenyl)-N-[(2R)-1-oxo-1-piperidin-1-ylpropan-2-yl]acetamide |
| SMILES | C[C@@H](NC(=O)Cc1ccc(Cl)cc1)C(=O)N1CCCCC1 |
| InChI | InChI=1S/C16H21ClN2O2/c1-12(16(21)19-9-3-2-4-10-19)18-15(20)11-13-5-7-14(17)8-6-13/h5-8,12H,2-4,9-11H2,1H3,(H,18,20)/t12-/m1/s1 |
| InChIKey | UWXBEDAXTPMEHA-GFCCVEGCSA-N |
| XLogP | 2.40 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.81 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |