C14H17N3O2S2 — CID 94668314
(2R)-2-ethoxy-N-[4-(1,3,4-thiadiazol-2-ylsulfanyl)phenyl]butanamide (PubChem CID 94668314) has the molecular formula C14H17N3O2S2 and a molecular weight of 323.44 g/mol. Its IUPAC name is (2R)-2-ethoxy-N-[4-(1,3,4-thiadiazol-2-ylsulfanyl)phenyl]butanamide.
| Compound Name | (2R)-2-ethoxy-N-[4-(1,3,4-thiadiazol-2-ylsulfanyl)phenyl]butanamide |
|---|---|
| PubChem CID | 94668314 |
| Molecular Formula | C14H17N3O2S2 |
| Molecular Weight | 323.44 g/mol |
| Exact Mass | 323.08 |
| IUPAC Name | (2R)-2-ethoxy-N-[4-(1,3,4-thiadiazol-2-ylsulfanyl)phenyl]butanamide |
| SMILES | CCO[C@H](CC)C(=O)Nc1ccc(Sc2nncs2)cc1 |
| InChI | InChI=1S/C14H17N3O2S2/c1-3-12(19-4-2)13(18)16-10-5-7-11(8-6-10)21-14-17-15-9-20-14/h5-9,12H,3-4H2,1-2H3,(H,16,18)/t12-/m1/s1 |
| InChIKey | QBIJHFNVWMAXFZ-GFCCVEGCSA-N |
| XLogP | 3.44 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.44 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |