C19H18N2OS2 — CID 9467059
(E)-1-[(2S)-2-(1,3-benzothiazol-2-yl)piperidin-1-yl]-3-thiophen-3-ylprop-2-en-1-one (PubChem CID 9467059) has the molecular formula C19H18N2OS2 and a molecular weight of 354.50 g/mol. Its IUPAC name is (E)-1-[(2S)-2-(1,3-benzothiazol-2-yl)piperidin-1-yl]-3-thiophen-3-ylprop-2-en-1-one.
| Compound Name | (E)-1-[(2S)-2-(1,3-benzothiazol-2-yl)piperidin-1-yl]-3-thiophen-3-ylprop-2-en-1-one |
|---|---|
| PubChem CID | 9467059 |
| Molecular Formula | C19H18N2OS2 |
| Molecular Weight | 354.50 g/mol |
| Exact Mass | 354.09 |
| IUPAC Name | (E)-1-[(2S)-2-(1,3-benzothiazol-2-yl)piperidin-1-yl]-3-thiophen-3-ylprop-2-en-1-one |
| SMILES | O=C(/C=C/c1ccsc1)N1CCCC[C@H]1c1nc2ccccc2s1 |
| InChI | InChI=1S/C19H18N2OS2/c22-18(9-8-14-10-12-23-13-14)21-11-4-3-6-16(21)19-20-15-5-1-2-7-17(15)24-19/h1-2,5,7-10,12-13,16H,3-4,6,11H2/b9-8+/t16-/m0/s1 |
| InChIKey | GYJQMXPURMWHML-FDMDGMSGSA-N |
| XLogP | 5.12 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.50 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|