C18H13ClN2O3 — CID 94671673
(3S)-5-oxo-1-(2-phenyl-1,3-benzoxazol-5-yl)pyrrolidine-3-carbonyl chloride (PubChem CID 94671673) has the molecular formula C18H13ClN2O3 and a molecular weight of 340.77 g/mol. Its IUPAC name is (3S)-5-oxo-1-(2-phenyl-1,3-benzoxazol-5-yl)pyrrolidine-3-carbonyl chloride.
| Compound Name | (3S)-5-oxo-1-(2-phenyl-1,3-benzoxazol-5-yl)pyrrolidine-3-carbonyl chloride |
|---|---|
| PubChem CID | 94671673 |
| Molecular Formula | C18H13ClN2O3 |
| Molecular Weight | 340.77 g/mol |
| Exact Mass | 340.06 |
| IUPAC Name | (3S)-5-oxo-1-(2-phenyl-1,3-benzoxazol-5-yl)pyrrolidine-3-carbonyl chloride |
| SMILES | O=C(Cl)[C@H]1CC(=O)N(c2ccc3oc(-c4ccccc4)nc3c2)C1 |
| InChI | InChI=1S/C18H13ClN2O3/c19-17(23)12-8-16(22)21(10-12)13-6-7-15-14(9-13)20-18(24-15)11-4-2-1-3-5-11/h1-7,9,12H,8,10H2/t12-/m0/s1 |
| InChIKey | JOEMEWWFWILEGC-LBPRGKRZSA-N |
| XLogP | 3.61 |
| TPSA | 63.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.77 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|