C10H14ClN5O — CID 94672018
7-chloro-5-ethyl-N-(2-methoxyethyl)-[1,2,4]triazolo[1,5-a]pyrimidin-2-amine (PubChem CID 94672018) has the molecular formula C10H14ClN5O and a molecular weight of 255.71 g/mol. Its IUPAC name is 7-chloro-5-ethyl-N-(2-methoxyethyl)-[1,2,4]triazolo[1,5-a]pyrimidin-2-amine.
| Compound Name | 7-chloro-5-ethyl-N-(2-methoxyethyl)-[1,2,4]triazolo[1,5-a]pyrimidin-2-amine |
|---|---|
| PubChem CID | 94672018 |
| Molecular Formula | C10H14ClN5O |
| Molecular Weight | 255.71 g/mol |
| Exact Mass | 255.09 |
| IUPAC Name | 7-chloro-5-ethyl-N-(2-methoxyethyl)-[1,2,4]triazolo[1,5-a]pyrimidin-2-amine |
| SMILES | CCc1cc(Cl)n2nc(NCCOC)nc2n1 |
| InChI | InChI=1S/C10H14ClN5O/c1-3-7-6-8(11)16-10(13-7)14-9(15-16)12-4-5-17-2/h6H,3-5H2,1-2H3,(H,12,15) |
| InChIKey | CNIZGICZZBNFMC-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 64.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.71 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|