C12H21N7 — CID 94672114
7-hydrazinyl-5,6-dimethyl-N-(3-methylbutyl)-[1,2,4]triazolo[1,5-a]pyrimidin-2-amine (PubChem CID 94672114) has the molecular formula C12H21N7 and a molecular weight of 263.35 g/mol. Its IUPAC name is 7-hydrazinyl-5,6-dimethyl-N-(3-methylbutyl)-[1,2,4]triazolo[1,5-a]pyrimidin-2-amine.
| Compound Name | 7-hydrazinyl-5,6-dimethyl-N-(3-methylbutyl)-[1,2,4]triazolo[1,5-a]pyrimidin-2-amine |
|---|---|
| PubChem CID | 94672114 |
| Molecular Formula | C12H21N7 |
| Molecular Weight | 263.35 g/mol |
| Exact Mass | 263.19 |
| IUPAC Name | 7-hydrazinyl-5,6-dimethyl-N-(3-methylbutyl)-[1,2,4]triazolo[1,5-a]pyrimidin-2-amine |
| SMILES | Cc1nc2nc(NCCC(C)C)nn2c(NN)c1C |
| InChI | InChI=1S/C12H21N7/c1-7(2)5-6-14-11-16-12-15-9(4)8(3)10(17-13)19(12)18-11/h7,17H,5-6,13H2,1-4H3,(H,14,18) |
| InChIKey | QTVHBEALJLQPRS-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 93.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.35 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|