About 2-(1,4-diazepan-1-yl)-N-(2-methoxyethyl)pyrimidin-4-amine
2-(1,4-diazepan-1-yl)-N-(2-methoxyethyl)pyrimidin-4-amine (PubChem CID 94672451) has the molecular formula C12H21N5O
and a molecular weight of 251.33 g/mol. Its IUPAC name is 2-(1,4-diazepan-1-yl)-N-(2-methoxyethyl)pyrimidin-4-amine.
Molecular Properties
| Compound Name | 2-(1,4-diazepan-1-yl)-N-(2-methoxyethyl)pyrimidin-4-amine |
| PubChem CID | 94672451 |
| Molecular Formula | C12H21N5O |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.17 |
| IUPAC Name | 2-(1,4-diazepan-1-yl)-N-(2-methoxyethyl)pyrimidin-4-amine |
| SMILES | COCCNc1ccnc(N2CCCNCC2)n1 |
| InChI | InChI=1S/C12H21N5O/c1-18-10-7-14-11-3-5-15-12(16-11)17-8-2-4-13-6-9-17/h3,5,13H,2,4,6-10H2,1H3,(H,14,15,16) |
| InChIKey | DFJFYBBNKQOHFM-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 62.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-(1,4-diazepan-1-yl)-N-(2-methoxyethyl)pyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1,4-diazepan-1-yl)-N-(2-methoxyethyl)pyrimidin-4-amine?
The IUPAC name of 2-(1,4-diazepan-1-yl)-N-(2-methoxyethyl)pyrimidin-4-amine (CID 94672451) is 2-(1,4-diazepan-1-yl)-N-(2-methoxyethyl)pyrimidin-4-amine.
What is the SMILES notation for 2-(1,4-diazepan-1-yl)-N-(2-methoxyethyl)pyrimidin-4-amine?
The canonical SMILES for 2-(1,4-diazepan-1-yl)-N-(2-methoxyethyl)pyrimidin-4-amine is COCCNc1ccnc(N2CCCNCC2)n1.
What is the InChIKey of 2-(1,4-diazepan-1-yl)-N-(2-methoxyethyl)pyrimidin-4-amine?
The InChIKey is DFJFYBBNKQOHFM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21N5O/c1-18-10-7-14-11-3-5-15-12(16-11)17-8-2-4-13-6-9-17/h3,5,13H,2,4,6-10H2,1H3,(H,14,15,16).
What are the key properties of 2-(1,4-diazepan-1-yl)-N-(2-methoxyethyl)pyrimidin-4-amine?
2-(1,4-diazepan-1-yl)-N-(2-methoxyethyl)pyrimidin-4-amine has a molecular weight of 251.33 g/mol, XLogP of 0.33, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,4-diazepan-1-yl)-N-(2-methoxyethyl)pyrimidin-4-amine is sourced from PubChem (CID 94672451), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).