C20H23BrN6 — CID 94674491
1-[[1-(4-bromo-3-methylphenyl)-5-pyridin-4-yltriazol-4-yl]methyl]piperidin-4-amine (PubChem CID 94674491) has the molecular formula C20H23BrN6 and a molecular weight of 427.35 g/mol. Its IUPAC name is 1-[[1-(4-bromo-3-methylphenyl)-5-pyridin-4-yltriazol-4-yl]methyl]piperidin-4-amine.
| Compound Name | 1-[[1-(4-bromo-3-methylphenyl)-5-pyridin-4-yltriazol-4-yl]methyl]piperidin-4-amine |
|---|---|
| PubChem CID | 94674491 |
| Molecular Formula | C20H23BrN6 |
| Molecular Weight | 427.35 g/mol |
| Exact Mass | 426.12 |
| IUPAC Name | 1-[[1-(4-bromo-3-methylphenyl)-5-pyridin-4-yltriazol-4-yl]methyl]piperidin-4-amine |
| SMILES | Cc1cc(-n2nnc(CN3CCC(N)CC3)c2-c2ccncc2)ccc1Br |
| InChI | InChI=1S/C20H23BrN6/c1-14-12-17(2-3-18(14)21)27-20(15-4-8-23-9-5-15)19(24-25-27)13-26-10-6-16(22)7-11-26/h2-5,8-9,12,16H,6-7,10-11,13,22H2,1H3 |
| InChIKey | GTGSPJHXXAHWMR-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 72.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.35 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |