C12H6F2N2O2S — CID 94675169
3-(3,4-difluorophenyl)-1H-thieno[3,2-d]pyrimidine-2,4-dione (PubChem CID 94675169) has the molecular formula C12H6F2N2O2S and a molecular weight of 280.25 g/mol. Its IUPAC name is 3-(3,4-difluorophenyl)-1H-thieno[3,2-d]pyrimidine-2,4-dione.
| Compound Name | 3-(3,4-difluorophenyl)-1H-thieno[3,2-d]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 94675169 |
| Molecular Formula | C12H6F2N2O2S |
| Molecular Weight | 280.25 g/mol |
| Exact Mass | 280.01 |
| IUPAC Name | 3-(3,4-difluorophenyl)-1H-thieno[3,2-d]pyrimidine-2,4-dione |
| SMILES | O=c1[nH]c2ccsc2c(=O)n1-c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C12H6F2N2O2S/c13-7-2-1-6(5-8(7)14)16-11(17)10-9(3-4-19-10)15-12(16)18/h1-5H,(H,15,18) |
| InChIKey | DNJURVFWFGBZST-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 54.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.25 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |