About N-[2-(4-tert-butyl-2,6-dimethylphenyl)ethyl]-1-oxidopyridin-1-ium-3-carboxamide
N-[2-(4-tert-butyl-2,6-dimethylphenyl)ethyl]-1-oxidopyridin-1-ium-3-carboxamide (PubChem CID 9467825) has the molecular formula C20H26N2O2
and a molecular weight of 326.44 g/mol. Its IUPAC name is N-[2-(4-tert-butyl-2,6-dimethylphenyl)ethyl]-1-oxidopyridin-1-ium-3-carboxamide.
Molecular Properties
| Compound Name | N-[2-(4-tert-butyl-2,6-dimethylphenyl)ethyl]-1-oxidopyridin-1-ium-3-carboxamide |
| PubChem CID | 9467825 |
| Molecular Formula | C20H26N2O2 |
| Molecular Weight | 326.44 g/mol |
| Exact Mass | 326.20 |
| IUPAC Name | N-[2-(4-tert-butyl-2,6-dimethylphenyl)ethyl]-1-oxidopyridin-1-ium-3-carboxamide |
| SMILES | Cc1cc(C(C)(C)C)cc(C)c1CCNC(=O)c1ccc[n+]([O-])c1 |
| InChI | InChI=1S/C20H26N2O2/c1-14-11-17(20(3,4)5)12-15(2)18(14)8-9-21-19(23)16-7-6-10-22(24)13-16/h6-7,10-13H,8-9H2,1-5H3,(H,21,23) |
| InChIKey | ZFXJWISRCPXSTL-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 56.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.44 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze N-[2-(4-tert-butyl-2,6-dimethylphenyl)ethyl]-1-oxidopyridin-1-ium-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(4-tert-butyl-2,6-dimethylphenyl)ethyl]-1-oxidopyridin-1-ium-3-carboxamide?
The IUPAC name of N-[2-(4-tert-butyl-2,6-dimethylphenyl)ethyl]-1-oxidopyridin-1-ium-3-carboxamide (CID 9467825) is N-[2-(4-tert-butyl-2,6-dimethylphenyl)ethyl]-1-oxidopyridin-1-ium-3-carboxamide.
What is the SMILES notation for N-[2-(4-tert-butyl-2,6-dimethylphenyl)ethyl]-1-oxidopyridin-1-ium-3-carboxamide?
The canonical SMILES for N-[2-(4-tert-butyl-2,6-dimethylphenyl)ethyl]-1-oxidopyridin-1-ium-3-carboxamide is Cc1cc(C(C)(C)C)cc(C)c1CCNC(=O)c1ccc[n+]([O-])c1.
What is the InChIKey of N-[2-(4-tert-butyl-2,6-dimethylphenyl)ethyl]-1-oxidopyridin-1-ium-3-carboxamide?
The InChIKey is ZFXJWISRCPXSTL-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H26N2O2/c1-14-11-17(20(3,4)5)12-15(2)18(14)8-9-21-19(23)16-7-6-10-22(24)13-16/h6-7,10-13H,8-9H2,1-5H3,(H,21,23).
What are the key properties of N-[2-(4-tert-butyl-2,6-dimethylphenyl)ethyl]-1-oxidopyridin-1-ium-3-carboxamide?
N-[2-(4-tert-butyl-2,6-dimethylphenyl)ethyl]-1-oxidopyridin-1-ium-3-carboxamide has a molecular weight of 326.44 g/mol, XLogP of 3.21, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(4-tert-butyl-2,6-dimethylphenyl)ethyl]-1-oxidopyridin-1-ium-3-carboxamide is sourced from PubChem (CID 9467825), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).