C24H27N5O2 — CID 9468357
3,4-dimethyl-N-[2-oxo-2-[4-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)anilino]ethyl]benzamide (PubChem CID 9468357) has the molecular formula C24H27N5O2 and a molecular weight of 417.51 g/mol. Its IUPAC name is 3,4-dimethyl-N-[2-oxo-2-[4-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)anilino]ethyl]benzamide.
| Compound Name | 3,4-dimethyl-N-[2-oxo-2-[4-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)anilino]ethyl]benzamide |
|---|---|
| PubChem CID | 9468357 |
| Molecular Formula | C24H27N5O2 |
| Molecular Weight | 417.51 g/mol |
| Exact Mass | 417.22 |
| IUPAC Name | 3,4-dimethyl-N-[2-oxo-2-[4-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)anilino]ethyl]benzamide |
| SMILES | Cc1ccc(C(=O)NCC(=O)Nc2ccc(-c3nnc4n3CCCCC4)cc2)cc1C |
| InChI | InChI=1S/C24H27N5O2/c1-16-7-8-19(14-17(16)2)24(31)25-15-22(30)26-20-11-9-18(10-12-20)23-28-27-21-6-4-3-5-13-29(21)23/h7-12,14H,3-6,13,15H2,1-2H3,(H,25,31)(H,26,30) |
| InChIKey | DETZVFHJXBZDFK-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 88.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.51 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |