C15H20O3 — CID 94689449
1-(2-methoxy-5-propan-2-ylphenyl)pentane-1,4-dione (PubChem CID 94689449) has the molecular formula C15H20O3 and a molecular weight of 248.32 g/mol. Its IUPAC name is 1-(2-methoxy-5-propan-2-ylphenyl)pentane-1,4-dione.
| Compound Name | 1-(2-methoxy-5-propan-2-ylphenyl)pentane-1,4-dione |
|---|---|
| PubChem CID | 94689449 |
| Molecular Formula | C15H20O3 |
| Molecular Weight | 248.32 g/mol |
| Exact Mass | 248.14 |
| IUPAC Name | 1-(2-methoxy-5-propan-2-ylphenyl)pentane-1,4-dione |
| SMILES | COc1ccc(C(C)C)cc1C(=O)CCC(C)=O |
| InChI | InChI=1S/C15H20O3/c1-10(2)12-6-8-15(18-4)13(9-12)14(17)7-5-11(3)16/h6,8-10H,5,7H2,1-4H3 |
| InChIKey | XPOAOXOAKDQUBU-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.32 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |