3-(2,4-dimethoxyphenyl)-3-oxopropane-1-sulfonic acid

C11H14O6S — CID 94698324

IUPAC3-(2,4-dimethoxyphenyl)-3-oxopropane-1-sulfonic acid
SMILESCOc1ccc(C(=O)CCS(=O)(=O)O)c(OC)c1
InChIInChI=1S/C11H14O6S/c1-16-8-3-4-9(11(7-8)17-2)10(12)5-6-18(13,14)15/h3-4,7H,5-6H2,1-2H3,(H,13,14,15)
InChIKeyQKSTVFGOBSYZSG-UHFFFAOYSA-N
MW274.29 g/mol
LogP1.16
Rot. Bonds6

About 3-(2,4-dimethoxyphenyl)-3-oxopropane-1-sulfonic acid

3-(2,4-dimethoxyphenyl)-3-oxopropane-1-sulfonic acid (PubChem CID 94698324) has the molecular formula C11H14O6S and a molecular weight of 274.29 g/mol. Its IUPAC name is 3-(2,4-dimethoxyphenyl)-3-oxopropane-1-sulfonic acid.

Molecular Properties

Compound Name3-(2,4-dimethoxyphenyl)-3-oxopropane-1-sulfonic acid
PubChem CID94698324
Molecular FormulaC11H14O6S
Molecular Weight274.29 g/mol
Exact Mass274.05
IUPAC Name3-(2,4-dimethoxyphenyl)-3-oxopropane-1-sulfonic acid
SMILESCOc1ccc(C(=O)CCS(=O)(=O)O)c(OC)c1
InChIInChI=1S/C11H14O6S/c1-16-8-3-4-9(11(7-8)17-2)10(12)5-6-18(13,14)15/h3-4,7H,5-6H2,1-2H3,(H,13,14,15)
InChIKeyQKSTVFGOBSYZSG-UHFFFAOYSA-N
XLogP1.16
TPSA89.90 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds6
Heavy Atoms18
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500274.29
LogP ≤ 51.16
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}

Analyze 3-(2,4-dimethoxyphenyl)-3-oxopropane-1-sulfonic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-(2,4-dimethoxyphenyl)-3-oxopropane-1-sulfonic acid?
The IUPAC name of 3-(2,4-dimethoxyphenyl)-3-oxopropane-1-sulfonic acid (CID 94698324) is 3-(2,4-dimethoxyphenyl)-3-oxopropane-1-sulfonic acid.
What is the SMILES notation for 3-(2,4-dimethoxyphenyl)-3-oxopropane-1-sulfonic acid?
The canonical SMILES for 3-(2,4-dimethoxyphenyl)-3-oxopropane-1-sulfonic acid is COc1ccc(C(=O)CCS(=O)(=O)O)c(OC)c1.
What is the InChIKey of 3-(2,4-dimethoxyphenyl)-3-oxopropane-1-sulfonic acid?
The InChIKey is QKSTVFGOBSYZSG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14O6S/c1-16-8-3-4-9(11(7-8)17-2)10(12)5-6-18(13,14)15/h3-4,7H,5-6H2,1-2H3,(H,13,14,15).
What are the key properties of 3-(2,4-dimethoxyphenyl)-3-oxopropane-1-sulfonic acid?
3-(2,4-dimethoxyphenyl)-3-oxopropane-1-sulfonic acid has a molecular weight of 274.29 g/mol, XLogP of 1.16, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,4-dimethoxyphenyl)-3-oxopropane-1-sulfonic acid is sourced from PubChem (CID 94698324), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).