About 2-[2-(5-tert-butyl-2-methylphenyl)-1,3-dioxan-2-yl]ethanamine
2-[2-(5-tert-butyl-2-methylphenyl)-1,3-dioxan-2-yl]ethanamine (PubChem CID 94700355) has the molecular formula C17H27NO2
and a molecular weight of 277.41 g/mol. Its IUPAC name is 2-[2-(5-tert-butyl-2-methylphenyl)-1,3-dioxan-2-yl]ethanamine.
Molecular Properties
| Compound Name | 2-[2-(5-tert-butyl-2-methylphenyl)-1,3-dioxan-2-yl]ethanamine |
| PubChem CID | 94700355 |
| Molecular Formula | C17H27NO2 |
| Molecular Weight | 277.41 g/mol |
| Exact Mass | 277.20 |
| IUPAC Name | 2-[2-(5-tert-butyl-2-methylphenyl)-1,3-dioxan-2-yl]ethanamine |
| SMILES | Cc1ccc(C(C)(C)C)cc1C1(CCN)OCCCO1 |
| InChI | InChI=1S/C17H27NO2/c1-13-6-7-14(16(2,3)4)12-15(13)17(8-9-18)19-10-5-11-20-17/h6-7,12H,5,8-11,18H2,1-4H3 |
| InChIKey | JOSCAPDABUQYFW-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.41 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[2-(5-tert-butyl-2-methylphenyl)-1,3-dioxan-2-yl]ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(5-tert-butyl-2-methylphenyl)-1,3-dioxan-2-yl]ethanamine?
The IUPAC name of 2-[2-(5-tert-butyl-2-methylphenyl)-1,3-dioxan-2-yl]ethanamine (CID 94700355) is 2-[2-(5-tert-butyl-2-methylphenyl)-1,3-dioxan-2-yl]ethanamine.
What is the SMILES notation for 2-[2-(5-tert-butyl-2-methylphenyl)-1,3-dioxan-2-yl]ethanamine?
The canonical SMILES for 2-[2-(5-tert-butyl-2-methylphenyl)-1,3-dioxan-2-yl]ethanamine is Cc1ccc(C(C)(C)C)cc1C1(CCN)OCCCO1.
What is the InChIKey of 2-[2-(5-tert-butyl-2-methylphenyl)-1,3-dioxan-2-yl]ethanamine?
The InChIKey is JOSCAPDABUQYFW-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H27NO2/c1-13-6-7-14(16(2,3)4)12-15(13)17(8-9-18)19-10-5-11-20-17/h6-7,12H,5,8-11,18H2,1-4H3.
What are the key properties of 2-[2-(5-tert-butyl-2-methylphenyl)-1,3-dioxan-2-yl]ethanamine?
2-[2-(5-tert-butyl-2-methylphenyl)-1,3-dioxan-2-yl]ethanamine has a molecular weight of 277.41 g/mol, XLogP of 3.23, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(5-tert-butyl-2-methylphenyl)-1,3-dioxan-2-yl]ethanamine is sourced from PubChem (CID 94700355), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).