C12H10ClN3OS — CID 94701516
2-[1-(3-chloro-4-methoxyphenyl)imidazol-2-yl]sulfanylacetonitrile (PubChem CID 94701516) has the molecular formula C12H10ClN3OS and a molecular weight of 279.75 g/mol. Its IUPAC name is 2-[1-(3-chloro-4-methoxyphenyl)imidazol-2-yl]sulfanylacetonitrile.
| Compound Name | 2-[1-(3-chloro-4-methoxyphenyl)imidazol-2-yl]sulfanylacetonitrile |
|---|---|
| PubChem CID | 94701516 |
| Molecular Formula | C12H10ClN3OS |
| Molecular Weight | 279.75 g/mol |
| Exact Mass | 279.02 |
| IUPAC Name | 2-[1-(3-chloro-4-methoxyphenyl)imidazol-2-yl]sulfanylacetonitrile |
| SMILES | COc1ccc(-n2ccnc2SCC#N)cc1Cl |
| InChI | InChI=1S/C12H10ClN3OS/c1-17-11-3-2-9(8-10(11)13)16-6-5-15-12(16)18-7-4-14/h2-3,5-6,8H,7H2,1H3 |
| InChIKey | XAHDDNKVIYLVCM-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 50.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.75 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |