C28H36N2O — CID 94725113
(1S,2S,5R,6R,9S,10S,13S)-1,5,6-trimethyl-17-phenyl-16,18-diazapentacyclo[11.8.0.02,10.05,9.015,20]henicosa-15,17,19-trien-6-ol (PubChem CID 94725113) has the molecular formula C28H36N2O and a molecular weight of 416.61 g/mol. Its IUPAC name is (1S,2S,5R,6R,9S,10S,13S)-1,5,6-trimethyl-17-phenyl-16,18-diazapentacyclo[11.8.0.02,10.05,9.015,20]henicosa-15,17,19-trien-6-ol.
| Compound Name | (1S,2S,5R,6R,9S,10S,13S)-1,5,6-trimethyl-17-phenyl-16,18-diazapentacyclo[11.8.0.02,10.05,9.015,20]henicosa-15,17,19-trien-6-ol |
|---|---|
| PubChem CID | 94725113 |
| Molecular Formula | C28H36N2O |
| Molecular Weight | 416.61 g/mol |
| Exact Mass | 416.28 |
| IUPAC Name | (1S,2S,5R,6R,9S,10S,13S)-1,5,6-trimethyl-17-phenyl-16,18-diazapentacyclo[11.8.0.02,10.05,9.015,20]henicosa-15,17,19-trien-6-ol |
| SMILES | C[C@]12Cc3cnc(-c4ccccc4)nc3C[C@@H]1CC[C@H]1[C@@H]2CC[C@]2(C)[C@H]1CC[C@@]2(C)O |
| InChI | InChI=1S/C28H36N2O/c1-26-16-19-17-29-25(18-7-5-4-6-8-18)30-24(19)15-20(26)9-10-21-22(26)11-13-27(2)23(21)12-14-28(27,3)31/h4-8,17,20-23,31H,9-16H2,1-3H3/t20-,21-,22-,23-,26-,27+,28+/m0/s1 |
| InChIKey | PHBHRCDYKYBQFC-YEGZKXCGSA-N |
| XLogP | 5.85 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.61 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |