C21H35N3O3S — CID 9473171
5-(diethylsulfamoyl)-2-methyl-N-[3-[(2S)-2-methylpiperidin-1-yl]propyl]benzamide (PubChem CID 9473171) has the molecular formula C21H35N3O3S and a molecular weight of 409.60 g/mol. Its IUPAC name is 5-(diethylsulfamoyl)-2-methyl-N-[3-[(2S)-2-methylpiperidin-1-yl]propyl]benzamide.
| Compound Name | 5-(diethylsulfamoyl)-2-methyl-N-[3-[(2S)-2-methylpiperidin-1-yl]propyl]benzamide |
|---|---|
| PubChem CID | 9473171 |
| Molecular Formula | C21H35N3O3S |
| Molecular Weight | 409.60 g/mol |
| Exact Mass | 409.24 |
| IUPAC Name | 5-(diethylsulfamoyl)-2-methyl-N-[3-[(2S)-2-methylpiperidin-1-yl]propyl]benzamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(C)c(C(=O)NCCCN2CCCC[C@@H]2C)c1 |
| InChI | InChI=1S/C21H35N3O3S/c1-5-24(6-2)28(26,27)19-12-11-17(3)20(16-19)21(25)22-13-9-15-23-14-8-7-10-18(23)4/h11-12,16,18H,5-10,13-15H2,1-4H3,(H,22,25)/t18-/m0/s1 |
| InChIKey | OZQLICCMAQVUBX-SFHVURJKSA-N |
| XLogP | 3.02 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.60 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|