C21H27N3O2S — CID 9473547
N-[4-[3-[(2R)-2-methylpiperidin-1-yl]propylcarbamoyl]phenyl]thiophene-2-carboxamide (PubChem CID 9473547) has the molecular formula C21H27N3O2S and a molecular weight of 385.53 g/mol. Its IUPAC name is N-[4-[3-[(2R)-2-methylpiperidin-1-yl]propylcarbamoyl]phenyl]thiophene-2-carboxamide.
| Compound Name | N-[4-[3-[(2R)-2-methylpiperidin-1-yl]propylcarbamoyl]phenyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 9473547 |
| Molecular Formula | C21H27N3O2S |
| Molecular Weight | 385.53 g/mol |
| Exact Mass | 385.18 |
| IUPAC Name | N-[4-[3-[(2R)-2-methylpiperidin-1-yl]propylcarbamoyl]phenyl]thiophene-2-carboxamide |
| SMILES | C[C@@H]1CCCCN1CCCNC(=O)c1ccc(NC(=O)c2cccs2)cc1 |
| InChI | InChI=1S/C21H27N3O2S/c1-16-6-2-3-13-24(16)14-5-12-22-20(25)17-8-10-18(11-9-17)23-21(26)19-7-4-15-27-19/h4,7-11,15-16H,2-3,5-6,12-14H2,1H3,(H,22,25)(H,23,26)/t16-/m1/s1 |
| InChIKey | XUOUTJXBSSFLGU-MRXNPFEDSA-N |
| XLogP | 3.99 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.53 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|