C16H16N4S — CID 947382
(2-phenyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl)hydrazine (PubChem CID 947382) has the molecular formula C16H16N4S and a molecular weight of 296.40 g/mol. Its IUPAC name is (2-phenyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl)hydrazine.
| Compound Name | (2-phenyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl)hydrazine |
|---|---|
| PubChem CID | 947382 |
| Molecular Formula | C16H16N4S |
| Molecular Weight | 296.40 g/mol |
| Exact Mass | 296.11 |
| IUPAC Name | (2-phenyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl)hydrazine |
| SMILES | NNc1nc(-c2ccccc2)nc2sc3c(c12)CCCC3 |
| InChI | InChI=1S/C16H16N4S/c17-20-15-13-11-8-4-5-9-12(11)21-16(13)19-14(18-15)10-6-2-1-3-7-10/h1-3,6-7H,4-5,8-9,17H2,(H,18,19,20) |
| InChIKey | FJJSQIUPILXYQS-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.40 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|