C21H21N3O4 — CID 94744429
2-[(2R)-2-hydroxy-2-(4-propan-2-ylphenyl)ethyl]-6-(3-nitrophenyl)pyridazin-3-one (PubChem CID 94744429) has the molecular formula C21H21N3O4 and a molecular weight of 379.42 g/mol. Its IUPAC name is 2-[(2R)-2-hydroxy-2-(4-propan-2-ylphenyl)ethyl]-6-(3-nitrophenyl)pyridazin-3-one.
| Compound Name | 2-[(2R)-2-hydroxy-2-(4-propan-2-ylphenyl)ethyl]-6-(3-nitrophenyl)pyridazin-3-one |
|---|---|
| PubChem CID | 94744429 |
| Molecular Formula | C21H21N3O4 |
| Molecular Weight | 379.42 g/mol |
| Exact Mass | 379.15 |
| IUPAC Name | 2-[(2R)-2-hydroxy-2-(4-propan-2-ylphenyl)ethyl]-6-(3-nitrophenyl)pyridazin-3-one |
| SMILES | CC(C)c1ccc([C@@H](O)Cn2nc(-c3cccc([N+](=O)[O-])c3)ccc2=O)cc1 |
| InChI | InChI=1S/C21H21N3O4/c1-14(2)15-6-8-16(9-7-15)20(25)13-23-21(26)11-10-19(22-23)17-4-3-5-18(12-17)24(27)28/h3-12,14,20,25H,13H2,1-2H3/t20-/m0/s1 |
| InChIKey | UVGVMMJLVWAGQI-FQEVSTJZSA-N |
| XLogP | 3.68 |
| TPSA | 98.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.42 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|