C18H24N2O3 — CID 94745771
1-(4-aminobutyl)-3-[2-(4-methylphenoxy)ethoxy]pyridin-2-one (PubChem CID 94745771) has the molecular formula C18H24N2O3 and a molecular weight of 316.40 g/mol. Its IUPAC name is 1-(4-aminobutyl)-3-[2-(4-methylphenoxy)ethoxy]pyridin-2-one.
| Compound Name | 1-(4-aminobutyl)-3-[2-(4-methylphenoxy)ethoxy]pyridin-2-one |
|---|---|
| PubChem CID | 94745771 |
| Molecular Formula | C18H24N2O3 |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.18 |
| IUPAC Name | 1-(4-aminobutyl)-3-[2-(4-methylphenoxy)ethoxy]pyridin-2-one |
| SMILES | Cc1ccc(OCCOc2cccn(CCCCN)c2=O)cc1 |
| InChI | InChI=1S/C18H24N2O3/c1-15-6-8-16(9-7-15)22-13-14-23-17-5-4-12-20(18(17)21)11-3-2-10-19/h4-9,12H,2-3,10-11,13-14,19H2,1H3 |
| InChIKey | OTOADJIUYNYMJQ-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|