C16H11Cl2N3 — CID 94747257
3-[2-(3,4-dichlorophenyl)benzimidazol-1-yl]propanenitrile (PubChem CID 94747257) has the molecular formula C16H11Cl2N3 and a molecular weight of 316.19 g/mol. Its IUPAC name is 3-[2-(3,4-dichlorophenyl)benzimidazol-1-yl]propanenitrile.
| Compound Name | 3-[2-(3,4-dichlorophenyl)benzimidazol-1-yl]propanenitrile |
|---|---|
| PubChem CID | 94747257 |
| Molecular Formula | C16H11Cl2N3 |
| Molecular Weight | 316.19 g/mol |
| Exact Mass | 315.03 |
| IUPAC Name | 3-[2-(3,4-dichlorophenyl)benzimidazol-1-yl]propanenitrile |
| SMILES | N#CCCn1c(-c2ccc(Cl)c(Cl)c2)nc2ccccc21 |
| InChI | InChI=1S/C16H11Cl2N3/c17-12-7-6-11(10-13(12)18)16-20-14-4-1-2-5-15(14)21(16)9-3-8-19/h1-2,4-7,10H,3,9H2 |
| InChIKey | JBWINSLCBDYIGQ-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 41.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.19 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |