About 2-[5,6-dimethyl-2-(trichloromethyl)benzimidazol-1-yl]acetic acid
2-[5,6-dimethyl-2-(trichloromethyl)benzimidazol-1-yl]acetic acid (PubChem CID 94748222) has the molecular formula C12H11Cl3N2O2
and a molecular weight of 321.59 g/mol. Its IUPAC name is 2-[5,6-dimethyl-2-(trichloromethyl)benzimidazol-1-yl]acetic acid.
Molecular Properties
| Compound Name | 2-[5,6-dimethyl-2-(trichloromethyl)benzimidazol-1-yl]acetic acid |
| PubChem CID | 94748222 |
| Molecular Formula | C12H11Cl3N2O2 |
| Molecular Weight | 321.59 g/mol |
| Exact Mass | 319.99 |
| IUPAC Name | 2-[5,6-dimethyl-2-(trichloromethyl)benzimidazol-1-yl]acetic acid |
| SMILES | Cc1cc2nc(C(Cl)(Cl)Cl)n(CC(=O)O)c2cc1C |
| InChI | InChI=1S/C12H11Cl3N2O2/c1-6-3-8-9(4-7(6)2)17(5-10(18)19)11(16-8)12(13,14)15/h3-4H,5H2,1-2H3,(H,18,19) |
| InChIKey | MGNYPHBDNISSQO-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.59 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-[5,6-dimethyl-2-(trichloromethyl)benzimidazol-1-yl]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[5,6-dimethyl-2-(trichloromethyl)benzimidazol-1-yl]acetic acid?
The IUPAC name of 2-[5,6-dimethyl-2-(trichloromethyl)benzimidazol-1-yl]acetic acid (CID 94748222) is 2-[5,6-dimethyl-2-(trichloromethyl)benzimidazol-1-yl]acetic acid.
What is the SMILES notation for 2-[5,6-dimethyl-2-(trichloromethyl)benzimidazol-1-yl]acetic acid?
The canonical SMILES for 2-[5,6-dimethyl-2-(trichloromethyl)benzimidazol-1-yl]acetic acid is Cc1cc2nc(C(Cl)(Cl)Cl)n(CC(=O)O)c2cc1C.
What is the InChIKey of 2-[5,6-dimethyl-2-(trichloromethyl)benzimidazol-1-yl]acetic acid?
The InChIKey is MGNYPHBDNISSQO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11Cl3N2O2/c1-6-3-8-9(4-7(6)2)17(5-10(18)19)11(16-8)12(13,14)15/h3-4H,5H2,1-2H3,(H,18,19).
What are the key properties of 2-[5,6-dimethyl-2-(trichloromethyl)benzimidazol-1-yl]acetic acid?
2-[5,6-dimethyl-2-(trichloromethyl)benzimidazol-1-yl]acetic acid has a molecular weight of 321.59 g/mol, XLogP of 3.56, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[5,6-dimethyl-2-(trichloromethyl)benzimidazol-1-yl]acetic acid is sourced from PubChem (CID 94748222), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).