About 3-[5,6-dimethoxy-2-(2-methylphenyl)benzimidazol-1-yl]propanenitrile
3-[5,6-dimethoxy-2-(2-methylphenyl)benzimidazol-1-yl]propanenitrile (PubChem CID 94748439) has the molecular formula C19H19N3O2
and a molecular weight of 321.38 g/mol. Its IUPAC name is 3-[5,6-dimethoxy-2-(2-methylphenyl)benzimidazol-1-yl]propanenitrile.
Molecular Properties
| Compound Name | 3-[5,6-dimethoxy-2-(2-methylphenyl)benzimidazol-1-yl]propanenitrile |
| PubChem CID | 94748439 |
| Molecular Formula | C19H19N3O2 |
| Molecular Weight | 321.38 g/mol |
| Exact Mass | 321.15 |
| IUPAC Name | 3-[5,6-dimethoxy-2-(2-methylphenyl)benzimidazol-1-yl]propanenitrile |
| SMILES | COc1cc2nc(-c3ccccc3C)n(CCC#N)c2cc1OC |
| InChI | InChI=1S/C19H19N3O2/c1-13-7-4-5-8-14(13)19-21-15-11-17(23-2)18(24-3)12-16(15)22(19)10-6-9-20/h4-5,7-8,11-12H,6,10H2,1-3H3 |
| InChIKey | ORLSQGWVOWOZSU-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 60.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.38 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-[5,6-dimethoxy-2-(2-methylphenyl)benzimidazol-1-yl]propanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[5,6-dimethoxy-2-(2-methylphenyl)benzimidazol-1-yl]propanenitrile?
The IUPAC name of 3-[5,6-dimethoxy-2-(2-methylphenyl)benzimidazol-1-yl]propanenitrile (CID 94748439) is 3-[5,6-dimethoxy-2-(2-methylphenyl)benzimidazol-1-yl]propanenitrile.
What is the SMILES notation for 3-[5,6-dimethoxy-2-(2-methylphenyl)benzimidazol-1-yl]propanenitrile?
The canonical SMILES for 3-[5,6-dimethoxy-2-(2-methylphenyl)benzimidazol-1-yl]propanenitrile is COc1cc2nc(-c3ccccc3C)n(CCC#N)c2cc1OC.
What is the InChIKey of 3-[5,6-dimethoxy-2-(2-methylphenyl)benzimidazol-1-yl]propanenitrile?
The InChIKey is ORLSQGWVOWOZSU-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H19N3O2/c1-13-7-4-5-8-14(13)19-21-15-11-17(23-2)18(24-3)12-16(15)22(19)10-6-9-20/h4-5,7-8,11-12H,6,10H2,1-3H3.
What are the key properties of 3-[5,6-dimethoxy-2-(2-methylphenyl)benzimidazol-1-yl]propanenitrile?
3-[5,6-dimethoxy-2-(2-methylphenyl)benzimidazol-1-yl]propanenitrile has a molecular weight of 321.38 g/mol, XLogP of 3.94, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[5,6-dimethoxy-2-(2-methylphenyl)benzimidazol-1-yl]propanenitrile is sourced from PubChem (CID 94748439), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).