About 2-[2-(3-fluorophenyl)-5,6-dimethoxybenzimidazol-1-yl]acetonitrile
2-[2-(3-fluorophenyl)-5,6-dimethoxybenzimidazol-1-yl]acetonitrile (PubChem CID 94748447) has the molecular formula C17H14FN3O2
and a molecular weight of 311.32 g/mol. Its IUPAC name is 2-[2-(3-fluorophenyl)-5,6-dimethoxybenzimidazol-1-yl]acetonitrile.
Molecular Properties
| Compound Name | 2-[2-(3-fluorophenyl)-5,6-dimethoxybenzimidazol-1-yl]acetonitrile |
| PubChem CID | 94748447 |
| Molecular Formula | C17H14FN3O2 |
| Molecular Weight | 311.32 g/mol |
| Exact Mass | 311.11 |
| IUPAC Name | 2-[2-(3-fluorophenyl)-5,6-dimethoxybenzimidazol-1-yl]acetonitrile |
| SMILES | COc1cc2nc(-c3cccc(F)c3)n(CC#N)c2cc1OC |
| InChI | InChI=1S/C17H14FN3O2/c1-22-15-9-13-14(10-16(15)23-2)21(7-6-19)17(20-13)11-4-3-5-12(18)8-11/h3-5,8-10H,7H2,1-2H3 |
| InChIKey | BNJCHIKFRTUVPE-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 60.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.32 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[2-(3-fluorophenyl)-5,6-dimethoxybenzimidazol-1-yl]acetonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(3-fluorophenyl)-5,6-dimethoxybenzimidazol-1-yl]acetonitrile?
The IUPAC name of 2-[2-(3-fluorophenyl)-5,6-dimethoxybenzimidazol-1-yl]acetonitrile (CID 94748447) is 2-[2-(3-fluorophenyl)-5,6-dimethoxybenzimidazol-1-yl]acetonitrile.
What is the SMILES notation for 2-[2-(3-fluorophenyl)-5,6-dimethoxybenzimidazol-1-yl]acetonitrile?
The canonical SMILES for 2-[2-(3-fluorophenyl)-5,6-dimethoxybenzimidazol-1-yl]acetonitrile is COc1cc2nc(-c3cccc(F)c3)n(CC#N)c2cc1OC.
What is the InChIKey of 2-[2-(3-fluorophenyl)-5,6-dimethoxybenzimidazol-1-yl]acetonitrile?
The InChIKey is BNJCHIKFRTUVPE-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H14FN3O2/c1-22-15-9-13-14(10-16(15)23-2)21(7-6-19)17(20-13)11-4-3-5-12(18)8-11/h3-5,8-10H,7H2,1-2H3.
What are the key properties of 2-[2-(3-fluorophenyl)-5,6-dimethoxybenzimidazol-1-yl]acetonitrile?
2-[2-(3-fluorophenyl)-5,6-dimethoxybenzimidazol-1-yl]acetonitrile has a molecular weight of 311.32 g/mol, XLogP of 3.38, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(3-fluorophenyl)-5,6-dimethoxybenzimidazol-1-yl]acetonitrile is sourced from PubChem (CID 94748447), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).