About 3-(5,6-dimethoxy-2-pyridin-2-ylbenzimidazol-1-yl)propan-1-amine
3-(5,6-dimethoxy-2-pyridin-2-ylbenzimidazol-1-yl)propan-1-amine (PubChem CID 94748494) has the molecular formula C17H20N4O2
and a molecular weight of 312.37 g/mol. Its IUPAC name is 3-(5,6-dimethoxy-2-pyridin-2-ylbenzimidazol-1-yl)propan-1-amine.
Molecular Properties
| Compound Name | 3-(5,6-dimethoxy-2-pyridin-2-ylbenzimidazol-1-yl)propan-1-amine |
| PubChem CID | 94748494 |
| Molecular Formula | C17H20N4O2 |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.16 |
| IUPAC Name | 3-(5,6-dimethoxy-2-pyridin-2-ylbenzimidazol-1-yl)propan-1-amine |
| SMILES | COc1cc2nc(-c3ccccn3)n(CCCN)c2cc1OC |
| InChI | InChI=1S/C17H20N4O2/c1-22-15-10-13-14(11-16(15)23-2)21(9-5-7-18)17(20-13)12-6-3-4-8-19-12/h3-4,6,8,10-11H,5,7,9,18H2,1-2H3 |
| InChIKey | NBOJLCJWXVPDEY-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-(5,6-dimethoxy-2-pyridin-2-ylbenzimidazol-1-yl)propan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(5,6-dimethoxy-2-pyridin-2-ylbenzimidazol-1-yl)propan-1-amine?
The IUPAC name of 3-(5,6-dimethoxy-2-pyridin-2-ylbenzimidazol-1-yl)propan-1-amine (CID 94748494) is 3-(5,6-dimethoxy-2-pyridin-2-ylbenzimidazol-1-yl)propan-1-amine.
What is the SMILES notation for 3-(5,6-dimethoxy-2-pyridin-2-ylbenzimidazol-1-yl)propan-1-amine?
The canonical SMILES for 3-(5,6-dimethoxy-2-pyridin-2-ylbenzimidazol-1-yl)propan-1-amine is COc1cc2nc(-c3ccccn3)n(CCCN)c2cc1OC.
What is the InChIKey of 3-(5,6-dimethoxy-2-pyridin-2-ylbenzimidazol-1-yl)propan-1-amine?
The InChIKey is NBOJLCJWXVPDEY-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H20N4O2/c1-22-15-10-13-14(11-16(15)23-2)21(9-5-7-18)17(20-13)12-6-3-4-8-19-12/h3-4,6,8,10-11H,5,7,9,18H2,1-2H3.
What are the key properties of 3-(5,6-dimethoxy-2-pyridin-2-ylbenzimidazol-1-yl)propan-1-amine?
3-(5,6-dimethoxy-2-pyridin-2-ylbenzimidazol-1-yl)propan-1-amine has a molecular weight of 312.37 g/mol, XLogP of 2.46, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(5,6-dimethoxy-2-pyridin-2-ylbenzimidazol-1-yl)propan-1-amine is sourced from PubChem (CID 94748494), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).