About 3-[6-(4-fluorophenyl)-[1,3]dioxolo[4,5-f]benzimidazol-7-yl]propanenitrile
3-[6-(4-fluorophenyl)-[1,3]dioxolo[4,5-f]benzimidazol-7-yl]propanenitrile (PubChem CID 94748714) has the molecular formula C17H12FN3O2
and a molecular weight of 309.30 g/mol. Its IUPAC name is 3-[6-(4-fluorophenyl)-[1,3]dioxolo[4,5-f]benzimidazol-7-yl]propanenitrile.
Molecular Properties
| Compound Name | 3-[6-(4-fluorophenyl)-[1,3]dioxolo[4,5-f]benzimidazol-7-yl]propanenitrile |
| PubChem CID | 94748714 |
| Molecular Formula | C17H12FN3O2 |
| Molecular Weight | 309.30 g/mol |
| Exact Mass | 309.09 |
| IUPAC Name | 3-[6-(4-fluorophenyl)-[1,3]dioxolo[4,5-f]benzimidazol-7-yl]propanenitrile |
| SMILES | N#CCCn1c(-c2ccc(F)cc2)nc2cc3c(cc21)OCO3 |
| InChI | InChI=1S/C17H12FN3O2/c18-12-4-2-11(3-5-12)17-20-13-8-15-16(23-10-22-15)9-14(13)21(17)7-1-6-19/h2-5,8-9H,1,7,10H2 |
| InChIKey | AYOBPIIWCFMBFR-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 60.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.30 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-[6-(4-fluorophenyl)-[1,3]dioxolo[4,5-f]benzimidazol-7-yl]propanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[6-(4-fluorophenyl)-[1,3]dioxolo[4,5-f]benzimidazol-7-yl]propanenitrile?
The IUPAC name of 3-[6-(4-fluorophenyl)-[1,3]dioxolo[4,5-f]benzimidazol-7-yl]propanenitrile (CID 94748714) is 3-[6-(4-fluorophenyl)-[1,3]dioxolo[4,5-f]benzimidazol-7-yl]propanenitrile.
What is the SMILES notation for 3-[6-(4-fluorophenyl)-[1,3]dioxolo[4,5-f]benzimidazol-7-yl]propanenitrile?
The canonical SMILES for 3-[6-(4-fluorophenyl)-[1,3]dioxolo[4,5-f]benzimidazol-7-yl]propanenitrile is N#CCCn1c(-c2ccc(F)cc2)nc2cc3c(cc21)OCO3.
What is the InChIKey of 3-[6-(4-fluorophenyl)-[1,3]dioxolo[4,5-f]benzimidazol-7-yl]propanenitrile?
The InChIKey is AYOBPIIWCFMBFR-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H12FN3O2/c18-12-4-2-11(3-5-12)17-20-13-8-15-16(23-10-22-15)9-14(13)21(17)7-1-6-19/h2-5,8-9H,1,7,10H2.
What are the key properties of 3-[6-(4-fluorophenyl)-[1,3]dioxolo[4,5-f]benzimidazol-7-yl]propanenitrile?
3-[6-(4-fluorophenyl)-[1,3]dioxolo[4,5-f]benzimidazol-7-yl]propanenitrile has a molecular weight of 309.30 g/mol, XLogP of 3.48, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[6-(4-fluorophenyl)-[1,3]dioxolo[4,5-f]benzimidazol-7-yl]propanenitrile is sourced from PubChem (CID 94748714), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).