2-aminohexanoic acid

C6H13NO2 — CID 9475

IUPAC2-aminohexanoic acid
SMILESCCCCC(N)C(=O)O
InChIInChI=1S/C6H13NO2/c1-2-3-4-5(7)6(8)9/h5H,2-4,7H2,1H3,(H,8,9)
InChIKeyLRQKBLKVPFOOQJ-UHFFFAOYSA-N
MW131.17 g/mol
LogP0.59
Rot. Bonds4

About 2-aminohexanoic acid

2-aminohexanoic acid (PubChem CID 9475) has the molecular formula C6H13NO2 and a molecular weight of 131.17 g/mol. Its IUPAC name is 2-aminohexanoic acid.

Molecular Properties

Compound Name2-aminohexanoic acid
PubChem CID9475
Molecular FormulaC6H13NO2
Molecular Weight131.17 g/mol
Exact Mass131.09
IUPAC Name2-aminohexanoic acid
SMILESCCCCC(N)C(=O)O
InChIInChI=1S/C6H13NO2/c1-2-3-4-5(7)6(8)9/h5H,2-4,7H2,1H3,(H,8,9)
InChIKeyLRQKBLKVPFOOQJ-UHFFFAOYSA-N
XLogP0.59
TPSA63.32 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds4
Heavy Atoms9
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500131.17
LogP ≤ 50.59
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 2-aminohexanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-aminohexanoic acid?
The IUPAC name of 2-aminohexanoic acid (CID 9475) is 2-aminohexanoic acid.
What is the SMILES notation for 2-aminohexanoic acid?
The canonical SMILES for 2-aminohexanoic acid is CCCCC(N)C(=O)O.
What is the InChIKey of 2-aminohexanoic acid?
The InChIKey is LRQKBLKVPFOOQJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H13NO2/c1-2-3-4-5(7)6(8)9/h5H,2-4,7H2,1H3,(H,8,9).
What are the key properties of 2-aminohexanoic acid?
2-aminohexanoic acid has a molecular weight of 131.17 g/mol, XLogP of 0.59, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-aminohexanoic acid is sourced from PubChem (CID 9475), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).