About 3-[(2R)-2-aminobutyl]-5,5-dimethylimidazolidine-2,4-dione
3-[(2R)-2-aminobutyl]-5,5-dimethylimidazolidine-2,4-dione (PubChem CID 94753955) has the molecular formula C9H17N3O2
and a molecular weight of 199.25 g/mol. Its IUPAC name is 3-[(2R)-2-aminobutyl]-5,5-dimethylimidazolidine-2,4-dione.
Molecular Properties
| Compound Name | 3-[(2R)-2-aminobutyl]-5,5-dimethylimidazolidine-2,4-dione |
| PubChem CID | 94753955 |
| Molecular Formula | C9H17N3O2 |
| Molecular Weight | 199.25 g/mol |
| Exact Mass | 199.13 |
| IUPAC Name | 3-[(2R)-2-aminobutyl]-5,5-dimethylimidazolidine-2,4-dione |
| SMILES | CC[C@@H](N)CN1C(=O)NC(C)(C)C1=O |
| InChI | InChI=1S/C9H17N3O2/c1-4-6(10)5-12-7(13)9(2,3)11-8(12)14/h6H,4-5,10H2,1-3H3,(H,11,14)/t6-/m1/s1 |
| InChIKey | GKYGBHWSWLOHNY-ZCFIWIBFSA-N |
| XLogP | 0.05 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.25 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|
Analyze 3-[(2R)-2-aminobutyl]-5,5-dimethylimidazolidine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(2R)-2-aminobutyl]-5,5-dimethylimidazolidine-2,4-dione?
The IUPAC name of 3-[(2R)-2-aminobutyl]-5,5-dimethylimidazolidine-2,4-dione (CID 94753955) is 3-[(2R)-2-aminobutyl]-5,5-dimethylimidazolidine-2,4-dione.
What is the SMILES notation for 3-[(2R)-2-aminobutyl]-5,5-dimethylimidazolidine-2,4-dione?
The canonical SMILES for 3-[(2R)-2-aminobutyl]-5,5-dimethylimidazolidine-2,4-dione is CC[C@@H](N)CN1C(=O)NC(C)(C)C1=O.
What is the InChIKey of 3-[(2R)-2-aminobutyl]-5,5-dimethylimidazolidine-2,4-dione?
The InChIKey is GKYGBHWSWLOHNY-ZCFIWIBFSA-N. The full InChI is InChI=1S/C9H17N3O2/c1-4-6(10)5-12-7(13)9(2,3)11-8(12)14/h6H,4-5,10H2,1-3H3,(H,11,14)/t6-/m1/s1.
What are the key properties of 3-[(2R)-2-aminobutyl]-5,5-dimethylimidazolidine-2,4-dione?
3-[(2R)-2-aminobutyl]-5,5-dimethylimidazolidine-2,4-dione has a molecular weight of 199.25 g/mol, XLogP of 0.05, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(2R)-2-aminobutyl]-5,5-dimethylimidazolidine-2,4-dione is sourced from PubChem (CID 94753955), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).